alyssagormley615 alyssagormley615

03-10-2018
Mathematics

contestada

Write an equation of the line in point slope form that passes through the two given points (8,-8) slope 3

Respuesta :

03-10-2018

equation: y - k=m(x-h)
M: slope
given point: (h,k)
plug in
y- (-3)=3(x-8)

Answer Link

Otras preguntas

Last year, the average monthly revenue at the Yardley Times newspaper was $93,250. So far this year, the average has been 8% less than last year. What is the a

cosec(6b+pi/8)=sec(2b-pi/8)

Antihistamines sometimes reduce your ability to safely operate a motor vehicle? True or False? A. True B. False

Mr. Ryan bought 7 tickets to an ice show and spent a total of $43. Adult tickets cost $9 and children tickets cost $4. How many tickets of each type did Mr. Rya

Which of the following is an example of an atom "following" the octet rule? A) A chlorine atom loses two electrons B) A nitrogen atom that has 5 valence e

find the slope of each line 8x-3y=9

A line with a slope of 1 passes the point (2,10). what is its equation in slope-intercept form?

A scientist notices an increase in the glycose production in the plants he is studying . What are the possible reasons ?

Solve for q. 6q = -8 + 7q

Your large firm is about to change to a customer centered organization structure in which employees who have rarely had customer contact will now likely signifi