caraballosonia40 caraballosonia40

05-05-2020
Spanish

contestada

Busca dos analogías en el texto. Luego escríbelas.

Respuesta :

05-05-2020

Answer:

Look for two analogies in the text. Then write them down. There you go you can crown me the brainless.

Explanation:

Answer Link

Otras preguntas

What present day city did genghis khan conquer? Where did he begin his empire building ?

cosec(6b+pi/8)=sec(2b-pi/8)

Why does the sun rise late?

Displacement is to velocity as_____is to acceleration

Peppered moths vary in color from light gray to almost black. The color of any moth depends on how many black spots are found on its wings. The name "peppered"

what is a social institution

Percent concentration is one of the most common and basic concentration measurement used by general public. true or false?

If an illegal drug is removed from the body according to a zero-order process and the concentration drops from 300 ng/mL to 150 ng/mL in two hours, what will th

What is the logic 32+2 +24=63+ 5=

a furniture shop refinshes cabinets. employees use one of two methods to refinish each cabinet. method 1 takes 1 hour and the material costs $6. method 2 takes