Boone6568 Boone6568
  • 04-08-2020
  • Chemistry
contestada

Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

Respuesta :

michaeld4th
michaeld4th michaeld4th
  • 04-08-2020

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer Link
mohammedshamil190 mohammedshamil190
  • 04-08-2020

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer Link

Otras preguntas

Ronald spent $123.45 on school clothes. He counted his money and discovered that he had $36.55 left. How much money did he originally have?
4. How is a glacier formed? A the erosion and deposition of ice B the melting and refreezing of snow c the weathering and erosion of snow D the melting and prec
Which statement BEST describes the status of women during World War II?
Point Y is between points J and Q. JQ = 18 and YQ = 11. What is JY?
What are some Characteristics of the Golden eagle?
How did Greek mythology influence life in ancient Greece?
should standardized tests like the SAT or ACT be required to apply for college
Help ! I am stuck on this question please help
if A= and B=, find BA.
What is the height of the cone below? 3 in. 9 in. 27 in. 75 in.