churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

What was controversial about horace bushnell’s notion of christian nurture?

how to say hellow in different ways?a. holiiiib. bonjourc. haid. borednot serious answer

2. Three blocks, A,B and C of mass 2kg. 3kg. 5kg respectively kept side by side with one another are accelerated at 2m/s2 across a smooth horizontal surface by

Why doesn’t the total pressure increase when more gas is added to the chamber? (hint: what would you see if the volume of the chamber was fixed?)

What is the date and latitude for the greatest amount of insolation in the southern hemisphere?

What is the most likely reason for the performance problems of tri-state’s delivery personnel?

A strain of bacterial cells doubles inpopulation every 2 days. A single cell is placed in a dish with sufficient nutrients to sustain a colony. Which equation w

What is the difference between monism and pluralism? Do you find monism or pluralism to be more likely? Why?

What is the difference between drug-induced ""happiness"" and natural states of happiness?

A compass needle is a small _____ that responds to the magnet force exerted on it by a nearby magnetic field