jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

Read the excerpt below and answer the question. It remained, then, to conclude that it was put into me by a nature truly more perfect than was I and possessing

Suppose tulips are on sale for $.60 per bulb. How many tulip bulbs can you order if you have $14 to spend and shipping is $3.00? *

Each student on a committee of five students shakes hands with every other committee member. How many handshakes will there be in all?

which of the following statements is the best inference about this excerpt How mercifully can our great Creator treat his creatures, even in those conditions in

How does anne frank mature in the book

Experts/ace plzz helpp!!

Which assumption is part of the model of monopolistic competition?

What happens to the mass of substances during a chemical change?

Will and kendrick live in a state that requires that contracts involving transactions over $500 be in writing. if they enter a verbal agreement to buy a car for

If Mercury travels 29.74 (mi/s) how many miles does mercury travel in an hour?